Introduction：Basic information about CAS 58182-63-1|Itanoxone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Itanoxone |
|---|
| CAS Number | 58182-63-1 | Molecular Weight | 300.73600 |
|---|
| Density | 1.267g/cm3 | Boiling Point | 514.3ºC at 760 mmHg |
|---|
| Molecular Formula | C17H13ClO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 264.9ºC |
|---|
Names
| Name | 4-[4-(2-chlorophenyl)phenyl]-2-methylidene-4-oxobutanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.267g/cm3 |
|---|
| Boiling Point | 514.3ºC at 760 mmHg |
|---|
| Molecular Formula | C17H13ClO3 |
|---|
| Molecular Weight | 300.73600 |
|---|
| Flash Point | 264.9ºC |
|---|
| Exact Mass | 300.05500 |
|---|
| PSA | 54.37000 |
|---|
| LogP | 4.22060 |
|---|
| Index of Refraction | 1.596 |
|---|
| InChIKey | HJWLWNLAIBFKDO-UHFFFAOYSA-N |
|---|
| SMILES | C=C(CC(=O)c1ccc(-c2ccccc2Cl)cc1)C(=O)O |
|---|
Synonyms
| Acide (chloro-2' biphenylyl-4)-4 methylene-2 oxo-4 butyrique [French] |
| [14C]-Itanoxone |
| F 1379 |
| 2-(p-(o-Chlorophenyl)phenacyl)acrylic acid |
| 2-Methylene-4-oxo-4-(4'-ortho-chlorophenylphenyl)butyric acid |
| Itanoxonum [INN-Latin] |
| Itanoxono [INN-Spanish] |
| 4-[4-(o-Chlorphenyl)phenyl]-4-oxo-2-methylenbuttersaeure |
| Itanoxone |
