Introduction：Basic information about CAS 77788-21-7|tetcyclacis, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | tetcyclacis |
|---|
| CAS Number | 77788-21-7 | Molecular Weight | 273.72100 |
|---|
| Density | 1.97g/cm3 | Boiling Point | 407.4ºC at 760 mmHg |
|---|
| Molecular Formula | C13H12ClN5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 200.2ºC |
|---|
Names
| Name | tetcyclacis |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.97g/cm3 |
|---|
| Boiling Point | 407.4ºC at 760 mmHg |
|---|
| Molecular Formula | C13H12ClN5 |
|---|
| Molecular Weight | 273.72100 |
|---|
| Flash Point | 200.2ºC |
|---|
| Exact Mass | 273.07800 |
|---|
| PSA | 52.68000 |
|---|
| LogP | 0.92450 |
|---|
| Index of Refraction | 2.029 |
|---|
| InChIKey | DPOWHSMECVNHAT-YERPJTIDSA-N |
|---|
| SMILES | Clc1ccc(N2N=NC3C4CC(C5N=NC45)C32)cc1 |
|---|
Synonyms
| Ken BYO |
| BAS 106-00W |
| (3aR,4R,4aS,6aR,7R,7aS)-rel-1-(4-chlorophenyl)-3a,4,4a,6a,7,7a-hexahydro-4,7-methano-1H-[1,2]diazeto[3,4-f]benzotriazole |
| BAS 106 |
| Tetcyclacis [ISO] |
| Tetcyclacis |
| BAS 106-04W |
| Tetracyclacis |
| rel-(1R,2R,6S,7R,8R,11S)-5-(4-chlorophenyl)-3,4,5,9,10-pentaazatetracyclo[5.4.1.02,6.08,11]dodeca-3,9-diene |
| (1r,2r,6s,7r,8r,11s)-5-(4-chlorphenyl)-3,4,5,9,10-pentaazatetracyclo[5.4.1.02,6.08,11]dodeca-3,9-dien |
