Introduction:Basic information about CAS 71933-13-6|(4-amidinophenyl)methanesulfonyl fluoride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (4-amidinophenyl)methanesulfonyl fluoride |
|---|
| CAS Number | 71933-13-6 | Molecular Weight | 216.23300 |
|---|
| Density | 1.44g/cm3 | Boiling Point | 380.5ºC at 760 mmHg |
|---|
| Molecular Formula | C8H9FN2O2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 183.9ºC |
|---|
Names
| Name | (4-carbamimidoylphenyl)methanesulfonyl fluoride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.44g/cm3 |
|---|
| Boiling Point | 380.5ºC at 760 mmHg |
|---|
| Molecular Formula | C8H9FN2O2S |
|---|
| Molecular Weight | 216.23300 |
|---|
| Flash Point | 183.9ºC |
|---|
| Exact Mass | 216.03700 |
|---|
| PSA | 92.39000 |
|---|
| LogP | 2.65080 |
|---|
| Index of Refraction | 1.587 |
|---|
| InChIKey | PMHUSCHKTSTQEP-UHFFFAOYSA-N |
|---|
| SMILES | N=C(N)c1ccc(CS(=O)(=O)F)cc1 |
|---|
Synonyms
| (4-Amidinophenyl)methanesulfonyl fluoride |
| Benzenemethanesulfonyl fluoride,4-(aminoiminomethyl) |
| (p-Amidinophenyl)methanesulfonyl fluoride |