Introduction：Basic information about CAS 4989-59-7|2,3-di-3-pyridylbutane-2,3-diol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,3-di-3-pyridylbutane-2,3-diol |
|---|
| CAS Number | 4989-59-7 | Molecular Weight | 244.28900 |
|---|
| Density | 1.226g/cm3 | Boiling Point | 437.6ºC at 760 mmHg |
|---|
| Molecular Formula | C14H16N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 218.4ºC |
|---|
Names
| Name | 2,3-dipyridin-3-ylbutane-2,3-diol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.226g/cm3 |
|---|
| Boiling Point | 437.6ºC at 760 mmHg |
|---|
| Molecular Formula | C14H16N2O2 |
|---|
| Molecular Weight | 244.28900 |
|---|
| Flash Point | 218.4ºC |
|---|
| Exact Mass | 244.12100 |
|---|
| PSA | 66.24000 |
|---|
| LogP | 1.59180 |
|---|
| Index of Refraction | 1.598 |
|---|
| InChIKey | VVMJKASGEROCDA-UHFFFAOYSA-N |
|---|
| SMILES | CC(O)(c1cccnc1)C(C)(O)c1cccnc1 |
|---|
Synonyms
| 2,3-Di-3-pyridylbutane-2,3-diol |
| EINECS 225-649-9 |
| 2,3-Di-<3>pyridyl-2.3-butandiol |
| 2,3-di-3-pyridyl-2,3-butanediol |
| 2,3-di-pyridin-3-yl-butane-2,3-diol |
| 2,3-di-pyridin-3-yl-2,3-butanediol |
