Introduction：Basic information about CAS 24701-69-7|7-AMCA, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 7-AMCA |
|---|
| CAS Number | 24701-69-7 | Molecular Weight | 244.26800 |
|---|
| Density | 1.55 | Boiling Point | 511.4ºC at 760 mmHg |
|---|
| Molecular Formula | C9H12N2O4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 263.1ºC |
|---|
Names
| Name | (6R,7R)-7-amino-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.55 |
|---|
| Boiling Point | 511.4ºC at 760 mmHg |
|---|
| Molecular Formula | C9H12N2O4S |
|---|
| Molecular Weight | 244.26800 |
|---|
| Flash Point | 263.1ºC |
|---|
| Exact Mass | 244.05200 |
|---|
| PSA | 118.16000 |
|---|
| Vapour Pressure | 7.72E-12mmHg at 25°C |
|---|
| Index of Refraction | 1.663 |
|---|
| InChIKey | BDSDFCVDQUGOFB-SVGQVSJJSA-N |
|---|
| SMILES | COCC1=C(C(=O)O)N2C(=O)C(N)C2SC1 |
|---|
Safety Information
Synonyms
| 7-amino-3-methoxymethyl-3-cephem-4-carboxylic acid |
| (6R,7R)-7-amino-3-methoxymethylcephalosporanic acid |
| (6R,7R)-7-amino-3-methoxymethyl-3-cephem-4-carboxylic acid |
| aminohydroxyindanone |
| 7-amino-3-hydroxy-1-indanone |
| 7-amino-3-hydroxy-indan-1-one |
| 3-methoxymethyl-7-aminocephalosporanic acid |
| (6R,7R)-7-Amino-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| 7-AMCA |
