Introduction:Basic information about CAS 28081-12-1|4-CHLORO-4'-FLUOROCHALCONE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-CHLORO-4'-FLUOROCHALCONE |
|---|
| CAS Number | 28081-12-1 | Molecular Weight | 260.69100 |
|---|
| Density | 1.265g/cm3 | Boiling Point | 392.4ºC at 760mmHg |
|---|
| Molecular Formula | C15H10ClFO | Melting Point | / |
|---|
| MSDS | / | Flash Point | 191.1ºC |
|---|
Names
| Name | (E)-3-(4-chlorophenyl)-1-(4-fluorophenyl)prop-2-en-1-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.265g/cm3 |
|---|
| Boiling Point | 392.4ºC at 760mmHg |
|---|
| Molecular Formula | C15H10ClFO |
|---|
| Molecular Weight | 260.69100 |
|---|
| Flash Point | 191.1ºC |
|---|
| Exact Mass | 260.04000 |
|---|
| PSA | 17.07000 |
|---|
| LogP | 4.37520 |
|---|
| Vapour Pressure | 2.29E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.616 |
|---|
| InChIKey | WXGUVJMPLPVNHX-XCVCLJGOSA-N |
|---|
| SMILES | O=C(C=Cc1ccc(Cl)cc1)c1ccc(F)cc1 |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 37/39-26 |
|---|
Synonyms
| trans-4-Chloro-4'-fluorochalcone |
| 4-Chloro-4‘-fluorochalcone |
| 1-(4-chlorophenyl)-3-(4-fluorophenyl)prop-2-enone |
| (2E)-3-(4-chlorophenyl)-1-(4-fluorophenyl)prop-2-en-1-one |
| 4-(fluorophenyl) p-chlorostyryl ketone |
| MFCD00124123 |