Introduction：Basic information about CAS 6470-87-7|Anthraquinone-2-carbonyl Chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Anthraquinone-2-carbonyl Chloride |
|---|
| CAS Number | 6470-87-7 | Molecular Weight | 270.667 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 463.9±34.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H7ClO3 | Melting Point | 147ºC |
|---|
| MSDS | / | Flash Point | 195.1±26.2 °C |
|---|
Names
| Name | Anthraquinone-2-carbonyl Chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 463.9±34.0 °C at 760 mmHg |
|---|
| Melting Point | 147ºC |
|---|
| Molecular Formula | C15H7ClO3 |
|---|
| Molecular Weight | 270.667 |
|---|
| Flash Point | 195.1±26.2 °C |
|---|
| Exact Mass | 270.008362 |
|---|
| PSA | 51.21000 |
|---|
| LogP | 3.38 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.665 |
|---|
| InChIKey | DGJNWQJOASAMHY-UHFFFAOYSA-N |
|---|
| SMILES | O=C(Cl)c1ccc2c(c1)C(=O)c1ccccc1C2=O |
|---|
Safety Information
| Hazard Codes | C |
|---|
| Risk Phrases | 34 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
| RIDADR | UN 3261 |
|---|
| Packaging Group | III |
|---|
| HS Code | 2918300090 |
|---|
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 9,10-Dioxo-9,10-dihydro-2-anthracenecarbonyl chloride |
| 2-Anthracenecarbonyl chloride, 9,10-dihydro-9,10-dioxo- |
| 9,10-Dioxo-9,10-dihydroanthracene-2-carbonyl chloride |
| 9,10-dioxoanthracene-2-carbonyl chloride |
