Introduction：Basic information about CAS 3397-32-8|Z-Phe-OSu, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Z-Phe-OSu |
|---|
| CAS Number | 3397-32-8 | Molecular Weight | 396.393 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C21H20N2O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | (2,5-dioxopyrrolidin-1-yl) 3-phenyl-2-(phenylmethoxycarbonylamino)propanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Molecular Formula | C21H20N2O6 |
|---|
| Molecular Weight | 396.393 |
|---|
| Exact Mass | 396.132141 |
|---|
| PSA | 102.01000 |
|---|
| LogP | 2.12 |
|---|
| Appearance of Characters | Solid |
|---|
| Index of Refraction | 1.618 |
|---|
| InChIKey | MOJNKVWQJKPXCT-KRWDZBQOSA-N |
|---|
| SMILES | O=C(NC(Cc1ccccc1)C(=O)ON1C(=O)CCC1=O)OCc1ccccc1 |
|---|
| Storage condition | -15°C |
|---|
Synonyms
| 2,5-Dioxo-1-pyrrolidinyl N-[(benzyloxy)carbonyl]-L-phenylalaninate |
| Z-L-Phe-OH N-succinimidyl ester |
| Cbz-L-Phe-OSuc |
| 2,5-Dioxo-1-pyrrolidinyl N-[(benzyloxy)carbonyl]phenylalaninate |
| L-phenylalanine, N-[(phenylmethoxy)carbonyl]-, 2,5-dioxo-1-pyrrolidinyl ester |
| Z-L-Phe-OSu |
| 2,5-Dioxopyrrolidin-1-yl N-[(benzyloxy)carbonyl]-L-phenylalaninate |
| Cbz-L-Phe-OSu |
| Phenylalanine, N-[(phenylmethoxy)carbonyl]-, 2,5-dioxo-1-pyrrolidinyl ester |
| EINECS 222-254-3 |
| Z-Phe-ONSu |
| Benzyl (S)-(2-((2,5-dioxo-1-pyrrolidinyl)oxy)-2-oxo-1-(phenylmethyl)ethyl)-carbamate |
| Z-Phe-Osu |
