Introduction:Basic information about CAS 7756-87-8|1,3-Dichloro-1,1,3,3-tetraphenyldisiloxane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,3-Dichloro-1,1,3,3-tetraphenyldisiloxane |
|---|
| CAS Number | 7756-87-8 | Molecular Weight | 451.492 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 474.9±18.0 °C at 760 mmHg |
|---|
| Molecular Formula | C24H20Cl2OSi2 | Melting Point | 36-38ºC |
|---|
| MSDS | / | Flash Point | 199.2±13.3 °C |
|---|
Names
| Name | chloro-[chloro(diphenyl)silyl]oxy-diphenylsilane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 474.9±18.0 °C at 760 mmHg |
|---|
| Melting Point | 36-38ºC |
|---|
| Molecular Formula | C24H20Cl2OSi2 |
|---|
| Molecular Weight | 451.492 |
|---|
| Flash Point | 199.2±13.3 °C |
|---|
| Exact Mass | 450.042969 |
|---|
| PSA | 9.23000 |
|---|
| LogP | 11.98 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.621 |
|---|
| InChIKey | YQULWRCMYAXEAV-UHFFFAOYSA-N |
|---|
| SMILES | Cl[Si](O[Si](Cl)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1 |
|---|
Safety Information
| Hazard Codes | C: Corrosive; |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | 26-36/37/39-45-27 |
|---|
| RIDADR | UN2987 |
|---|
Synonyms
| Disiloxane, 1,3-dichloro-1,1,3,3-tetraphenyl- |
| ClPh2Si-O-SiPh2Cl |
| 1,3-Dichlorotetraphenyldisiloxane |
| 1,3-dichloro-1,1,3,3-tetraphenyldisiloxanel |
| EINECS 231-815-1 |
| Benzene, 1,1',1'',1'''-(1,3-dichloro-1,3-disiloxanediylidene)tetrakis- |
| tetraphenyl-1,3-dichloro-disiloxane |
| 1,3-Dichloro-1,1,3,3-tetraphenyldisiloxane |