Introduction:Basic information about CAS 500-89-0|thiambutosine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | thiambutosine |
|---|
| CAS Number | 500-89-0 | Molecular Weight | 343.48600 |
|---|
| Density | 1.187g/cm3 | Boiling Point | 478.9ºC at 760mmHg |
|---|
| Molecular Formula | C19H25N3OS | Melting Point | / |
|---|
| MSDS | / | Flash Point | 243.4ºC |
|---|
Names
| Name | 1-(4-butoxyphenyl)-3-[4-(dimethylamino)phenyl]thiourea |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.187g/cm3 |
|---|
| Boiling Point | 478.9ºC at 760mmHg |
|---|
| Molecular Formula | C19H25N3OS |
|---|
| Molecular Weight | 343.48600 |
|---|
| Flash Point | 243.4ºC |
|---|
| Exact Mass | 343.17200 |
|---|
| PSA | 68.62000 |
|---|
| LogP | 4.88640 |
|---|
| Index of Refraction | 1.663 |
|---|
| InChIKey | JYCBKPOKWDDOOV-UHFFFAOYSA-N |
|---|
| SMILES | CCCCOc1ccc(NC(=S)Nc2ccc(N(C)C)cc2)cc1 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
Customs
| HS Code | 2930909090 |
|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| N-(4-Butoxy-phenyl)-N'-(4-dimethylamino-phenyl)-thioharnstoff |
| EINECS 207-914-0 |
| Tiambutosina [INN-Spanish] |
| N'-<4-Butyloxy-phenyl>-N-<4-dimethylamino-phenyl>-thioharnstoff |
| SU 1906 |
| Summit 1906 |
| N'-<4-Dimethylamino-phenyl>-N-<4-butyloxy-phenyl>-thioharnstoff |
| Thiambutosine |
| Thiambutosinum [INN-Latin] |
| Ciba 1906 |
| CARBANILIDE,4-BUTOXY-4'-(DIMETHYLAMINO)THIO |
| N-(4-butoxy-phenyl)-N'-(4-dimethylamino-phenyl)-thiourea |