Introduction：Basic information about CAS 4989-94-0|Triamcinolone furetonide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Triamcinolone furetonide |
|---|
| CAS Number | 4989-94-0 | Molecular Weight | 578.62500 |
|---|
| Density | 1.37 g/cm3 | Boiling Point | 708.9ºC at 760mmHg |
|---|
| Molecular Formula | C33H35FO8 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 382.5ºC |
|---|
Names
| Name | Triamcinolone furetonide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.37 g/cm3 |
|---|
| Boiling Point | 708.9ºC at 760mmHg |
|---|
| Molecular Formula | C33H35FO8 |
|---|
| Molecular Weight | 578.62500 |
|---|
| Flash Point | 382.5ºC |
|---|
| Exact Mass | 578.23200 |
|---|
| PSA | 112.27000 |
|---|
| LogP | 5.02970 |
|---|
| Index of Refraction | 1.628 |
|---|
| InChIKey | OSWKQSQWSQSPQH-GNFRAIDCSA-N |
|---|
| SMILES | CC1(C)OC2CC3C4CCC5=CC(=O)C=CC5(C)C4(F)C(O)CC3(C)C2(C(=O)COC(=O)c2cc3ccccc3o2)O1 |
|---|
Synonyms
| UNII-O49NOC9ROC |
| Triamcinoloni furetonidum |
| Tiamcinoloni furetonidum |
| Triamcinoloni furetonidum [INN-Latin] |
| Tiamcinoloni furetonidum [INN-Latin] |
| Triamcinolona furetonido |
| EINECS 225-650-4 |
