Introduction：Basic information about CAS 79130-64-6|Ansoxetine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ansoxetine |
|---|
| CAS Number | 79130-64-6 | Molecular Weight | 399.48200 |
|---|
| Density | 1.181g/cm3 | Boiling Point | 568ºC at 760 mmHg |
|---|
| Molecular Formula | C26H25NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 297.3ºC |
|---|
Names
| Name | 6-[3-(dimethylamino)-1-phenylpropoxy]-2-phenylchromen-4-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.181g/cm3 |
|---|
| Boiling Point | 568ºC at 760 mmHg |
|---|
| Molecular Formula | C26H25NO3 |
|---|
| Molecular Weight | 399.48200 |
|---|
| Flash Point | 297.3ºC |
|---|
| Exact Mass | 399.18300 |
|---|
| PSA | 42.68000 |
|---|
| LogP | 5.53180 |
|---|
| Index of Refraction | 1.612 |
|---|
| InChIKey | JDQWJVUVMKPZLU-UHFFFAOYSA-N |
|---|
| SMILES | CN(C)CCC(Oc1ccc2oc(-c3ccccc3)cc(=O)c2c1)c1ccccc1 |
|---|
Synonyms
| 6-(3-dimethylamino-1-phenylpropoxy)-2-phenylchromen-4-one |
| Ansoxetine |
| Ansoxetine [INN] |
