Introduction:Basic information about CAS 71628-96-1|2,6-Epoxy-2H-naphthaceno[1,2-b]oxocin-9,16-dione,4-(dimethylamino)-3,4,5,6,11,, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,6-Epoxy-2H-naphthaceno[1,2-b]oxocin-9,16-dione,4-(dimethylamino)-3,4,5,6,11,12,13,14-octahydro-3,5,8,10,13-pentahydroxy-11-methoxy-6,13-dimethyl-,(2R,3S,4R,5R,6R,11R,13R)- |
|---|
| CAS Number | 71628-96-1 | Molecular Weight | 541.54600 |
|---|
| Density | 1.59g/cm3 | Boiling Point | 800.1ºC at 760 mmHg |
|---|
| Molecular Formula | C28H31NO10 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 437.7ºC |
|---|
Names
| Name | Menogaril |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.59g/cm3 |
|---|
| Boiling Point | 800.1ºC at 760 mmHg |
|---|
| Molecular Formula | C28H31NO10 |
|---|
| Molecular Weight | 541.54600 |
|---|
| Flash Point | 437.7ºC |
|---|
| Exact Mass | 541.19500 |
|---|
| PSA | 166.22000 |
|---|
| LogP | 0.87380 |
|---|
| Index of Refraction | 1.719 |
|---|
| InChIKey | LWYJUZBXGAFFLP-UHFFFAOYSA-N |
|---|
| SMILES | COC1CC(C)(O)Cc2cc3c(c(O)c21)C(=O)c1c(O)cc2c(c1C3=O)OC1OC2(C)C(O)C(N(C)C)C1O |
|---|
Synonyms
| 7-chlor-1h-indol |
| indole-7-chloro |
| 7-con-O-methylnogarol |
| 7-Chlor-indol |
| 7-chloro indole |
| 7-Cl indole |