Introduction:Basic information about CAS 18625-22-4|H-D-Leu-Gly-Gly-OH, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | H-D-Leu-Gly-Gly-OH |
|---|
| CAS Number | 18625-22-4 | Molecular Weight | 245.27600 |
|---|
| Density | 1.199g/cm3 | Boiling Point | 573.7ºC at 760mmHg |
|---|
| Molecular Formula | C10H19N3O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 300.8ºC |
|---|
Names
| Name | 2-[[2-[[(2R)-2-amino-4-methylpentanoyl]amino]acetyl]amino]acetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.199g/cm3 |
|---|
| Boiling Point | 573.7ºC at 760mmHg |
|---|
| Molecular Formula | C10H19N3O4 |
|---|
| Molecular Weight | 245.27600 |
|---|
| Flash Point | 300.8ºC |
|---|
| Exact Mass | 245.13800 |
|---|
| PSA | 121.52000 |
|---|
| LogP | 0.15890 |
|---|
| Vapour Pressure | 1.17E-14mmHg at 25°C |
|---|
| Index of Refraction | -58 ° (C=2, H2O) |
|---|
| InChIKey | VWHGTYCRDRBSFI-SSDOTTSWSA-N |
|---|
| SMILES | CC(C)CC(N)C(=O)NCC(=O)NCC(=O)O |
|---|
| Storage condition | -15°C |
|---|
Safety Information
| Safety Phrases | S24/25 |
|---|
| RIDADR | 3288 |
|---|
| WGK Germany | 3 |
|---|
| RTECS | NL1800000 |
|---|
| HS Code | 2924199090 |
|---|
Customs
| HS Code | 2924199090 |
|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| L-Leucylglycylglycine |
| D-Leucylglycylglycine |
| (R)-2-(2-(2-Amino-4-methylpentanamido)acetamido)acetic acid |
| Glycine,D-leucylglycyl |
| H-Leu-Gly-Gly-OH |
| H-D-Leu-Gly-Gly-OH |
| EINECS 242-457-0 |
| MFCD00021740 |