Introduction：Basic information about CAS 828-35-3|1h,2h-octafluorocyclopentane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1h,2h-octafluorocyclopentane |
|---|
| CAS Number | 828-35-3 | Molecular Weight | 214.05700 |
|---|
| Density | 1.68 | Boiling Point | 79ºC |
|---|
| Molecular Formula | C5H2F8 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 1h,2h-octafluorocyclopentane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.68 |
|---|
| Boiling Point | 79ºC |
|---|
| Molecular Formula | C5H2F8 |
|---|
| Molecular Weight | 214.05700 |
|---|
| Exact Mass | 214.00300 |
|---|
| LogP | 2.58210 |
|---|
| Index of Refraction | 1.279 |
|---|
| InChIKey | QVEJLBREDQLBKB-UHFFFAOYSA-N |
|---|
| SMILES | FC1C(F)C(F)(F)C(F)(F)C1(F)F |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
Synonyms
| MFCD03094303 |
| 1H,2H-Octafluorcyclopentan |
| 1H,2H-Oktafluorcyclopentan |
| 1,2,3,10,11,11a-hexahydro-5H-pyrrolo<2,1-c><1,4>benzodiazepin-5-one |
| 1,1,2,2,3,3,4,5-octafluorocyclopentane |
| 1,2,3,3,4,4,5,5-octafluorocyclopentane |
| 5-Oxo-2,3,5,10,11,11a-hexahydro-1H-pyrrolo<2,1-c><1,4>benzdiazepin |
