Introduction:Basic information about CAS 652-31-3|Benzamide,2,3,4,5,6-pentafluoro-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzamide,2,3,4,5,6-pentafluoro- |
|---|
| CAS Number | 652-31-3 | Molecular Weight | 211.08900 |
|---|
| Density | 1.634g/cm3 | Boiling Point | 89.4ºC at 760 mmHg |
|---|
| Molecular Formula | C7H2F5NO | Melting Point | 146-149 °C(lit.) |
|---|
| MSDS | / | Flash Point | 7.8ºC |
|---|
Names
| Name | 2,3,4,5,6-pentafluorobenzamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.634g/cm3 |
|---|
| Boiling Point | 89.4ºC at 760 mmHg |
|---|
| Melting Point | 146-149 °C(lit.) |
|---|
| Molecular Formula | C7H2F5NO |
|---|
| Molecular Weight | 211.08900 |
|---|
| Flash Point | 7.8ºC |
|---|
| Exact Mass | 211.00600 |
|---|
| PSA | 43.09000 |
|---|
| LogP | 2.18130 |
|---|
| Index of Refraction | 1.456 |
|---|
| InChIKey | WPWWHXPRJFDTTJ-UHFFFAOYSA-N |
|---|
| SMILES | NC(=O)c1c(F)c(F)c(F)c(F)c1F |
|---|
Safety Information
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S37/39 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| Pentafluorobenzamide |
| perfluorobenzamide |
| Benzamide,pentafluoro |
| pentafluorobenzoyl amide |
| Benzamide,2,3,4,5,6-pentafluoro |
| EINECS 211-488-1 |
| 2,3,4,5,6-pentafluoro-benzamide |
| 2,3',4,4',5-PENTACHLOROBIPHENYL SOLUTION |
| MFCD00007971 |