Introduction:Basic information about CAS 49676-56-4|bis(1h,1h,2h,2h-perfluorooctyl)itaconate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | bis(1h,1h,2h,2h-perfluorooctyl)itaconate |
|---|
| CAS Number | 49676-56-4 | Molecular Weight | 822.27600 |
|---|
| Density | 1.584g/cm3 | Boiling Point | 381.764ºC at 760 mmHg |
|---|
| Molecular Formula | C21H12F26O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 178.354ºC |
|---|
Names
| Name | bis(1h,1h,2h,2h-perfluorooctyl)itaconate |
|---|
Chemical & Physical Properties
| Density | 1.584g/cm3 |
|---|
| Boiling Point | 381.764ºC at 760 mmHg |
|---|
| Molecular Formula | C21H12F26O4 |
|---|
| Molecular Weight | 822.27600 |
|---|
| Flash Point | 178.354ºC |
|---|
| Exact Mass | 822.03200 |
|---|
| PSA | 52.60000 |
|---|
| LogP | 9.27690 |
|---|
| Index of Refraction | 1.331 |
|---|
| InChIKey | INMZEORJCBRDMK-UHFFFAOYSA-N |
|---|
| SMILES | C=C(CC(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
|---|