Introduction：Basic information about CAS 344-00-3|ethyl 2-methyl-4,4,4-trifluoroacetoacetate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ethyl 2-methyl-4,4,4-trifluoroacetoacetate |
|---|
| CAS Number | 344-00-3 | Molecular Weight | 198.14000 |
|---|
| Density | 1,2 g/cm3 | Boiling Point | 144 °C |
|---|
| Molecular Formula | C7H9F3O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 47°C |
|---|
Names
| Name | ethyl 4,4,4-trifluoro-2-methyl-3-oxobutanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1,2 g/cm3 |
|---|
| Boiling Point | 144 °C |
|---|
| Molecular Formula | C7H9F3O3 |
|---|
| Molecular Weight | 198.14000 |
|---|
| Flash Point | 47°C |
|---|
| Exact Mass | 198.05000 |
|---|
| PSA | 43.37000 |
|---|
| LogP | 1.31700 |
|---|
| Index of Refraction | 1.374 |
|---|
| InChIKey | YLRGPBKEZVHOAW-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)C(C)C(=O)C(F)(F)F |
|---|
Safety Information
| Hazard Codes | F: Flammable;Xi: Irritant; |
|---|
| Risk Phrases | R10;R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| RIDADR | 3272 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 3 |
|---|
| HS Code | 2918300090 |
|---|
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| ethyl 2-methyl-4,4,4-trifluoroacetoacetate |
| ethyl 2-methyltrifluoroacetoacetate |
| 4,4,4-trifluoro-2-methyl-3-oxo-butyric acid ethyl ester |
| MFCD00190635 |
| Ethyl 4,4,4-trifluoro-2-methyl-3-oxobutanoate |
| ethyl-3-keto-2-methyl-4,4,4-trifluorobutanoate |
| ZLB0114 |
| ethyl 3-keto-2-methyl-4,4,4-trifluorobutyrate |
