Introduction:Basic information about CAS 3330-14-1|1,1,1,2,2,3,3-Heptafluoro-3-[[1,1,1,2,3,3-hexafluoro-3-(1,2,2,2-tetrafluoroetho, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,1,1,2,2,3,3-Heptafluoro-3-[[1,1,1,2,3,3-hexafluoro-3-(1,2,2,2-tetrafluoroethoxy)propan-2-yl]oxy]propane |
|---|
| CAS Number | 3330-14-1 | Molecular Weight | 452.06500 |
|---|
| Density | 1.659 | Boiling Point | 103-105ºC |
|---|
| Molecular Formula | C8HF17O2 | Melting Point | -122ºC |
|---|
| MSDS | / | Flash Point | 52.3ºC |
|---|
Names
| Name | 2h-perfluoro-5-methyl-3,6-dioxanonane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.659 |
|---|
| Boiling Point | 103-105ºC |
|---|
| Melting Point | -122ºC |
|---|
| Molecular Formula | C8HF17O2 |
|---|
| Molecular Weight | 452.06500 |
|---|
| Flash Point | 52.3ºC |
|---|
| Exact Mass | 451.97100 |
|---|
| PSA | 18.46000 |
|---|
| LogP | 5.48880 |
|---|
| Index of Refraction | 1.257 |
|---|
| InChIKey | PYSYKOPZHYNYSZ-UHFFFAOYSA-N |
|---|
| SMILES | FC(OC(F)(F)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)C(F)(F)F |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Safety Phrases | S23 |
|---|
Synonyms
| 2H-Perfluoro-5-methyl-3,6-dioxanonane |
| freone2 |
| Fluoroether E2~2H-Heptadecafluoro-5-methyl-3,6-dioxanonane |
| 1,1,1,2,4,4,5,7,7,8,8,9,9,9-tridecafluoro-5-trifluoromethyl-3,6-dioxanonane |
| 2,2,3,3,3-heptafluoro-hoxy]-1 |
| MFCD00054714 |
| FluoroetherE2 |