Introduction:Basic information about CAS 6574-15-8|1-(4-Nitrophenyl)piperidine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(4-Nitrophenyl)piperidine |
|---|
| CAS Number | 6574-15-8 | Molecular Weight | 206.24100 |
|---|
| Density | 1.188 g/cm3 | Boiling Point | 363.5ºC at 760 mmHg |
|---|
| Molecular Formula | C11H14N2O2 | Melting Point | 104-106°C |
|---|
| MSDS | / | Flash Point | 173.6ºC |
|---|
Names
| Name | 1-(4-Nitrophenyl)piperidine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.188 g/cm3 |
|---|
| Boiling Point | 363.5ºC at 760 mmHg |
|---|
| Melting Point | 104-106°C |
|---|
| Molecular Formula | C11H14N2O2 |
|---|
| Molecular Weight | 206.24100 |
|---|
| Flash Point | 173.6ºC |
|---|
| Exact Mass | 206.10600 |
|---|
| PSA | 49.06000 |
|---|
| LogP | 3.17330 |
|---|
| Index of Refraction | 1.706 |
|---|
| InChIKey | SGPLAXFUDTWHRS-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccc(N2CCCCC2)cc1 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S22-S36 |
|---|
| HS Code | 2933399090 |
|---|
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 1-Piperidino-4-nitrobenzene |
| 4-(piperidin-1-yl)-1-nitrobenzene |
| 1-nitro-4-piperidinobenzene |
| 4-(piperidin-1-yl)nitrobenzene |
| AURORA 2061 |
| MFCD00023662 |
| EINECS 229-492-7 |
| 4-CHLORO-2-AMINOPYRIMIDINE |
| BUTTPARK 9657-87 |
| N-(4-NITROPHENYL)PIPERIDINE |
| 1-(4-nitrophenyl)-1H-piperidine |