Introduction：Basic information about CAS 922178-94-7|(betaS)-beta-[[(tert-Butoxy)carbonyl]amino]-2,4,5-trifluorobenzenebutanoic ac, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (betaS)-beta-[[(tert-Butoxy)carbonyl]amino]-2,4,5-trifluorobenzenebutanoic acid |
|---|
| CAS Number | 922178-94-7 | Molecular Weight | 333.303 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 443.1±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H18F3NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 221.8±28.7 °C |
|---|
Names
| Name | (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(2,4,5-trifluorophenyl)butanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 443.1±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H18F3NO4 |
|---|
| Molecular Weight | 333.303 |
|---|
| Flash Point | 221.8±28.7 °C |
|---|
| Exact Mass | 333.118805 |
|---|
| PSA | 75.63000 |
|---|
| LogP | 3.35 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.494 |
|---|
| InChIKey | TUAXCHGULMWHIO-VIFPVBQESA-N |
|---|
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)O)Cc1cc(F)c(F)cc1F |
|---|
Synonyms
| Benzenebutanoic acid, β-[[(1,1-dimethylethoxy)carbonyl]amino]-2,4,5-trifluoro-, (βS)- |
| (3S)-3-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-4-(2,4,5-trifluorophenyl)butanoic acid |
| Boc-(S)-3-Amino-4-(2,4,5-trifluoro-phenyl)-butyric acid |
| (S)-3-(Boc-amino)-4-(2,4,5-trifluorophenyl)butanoic acid |
| (betaS)-beta-[[(tert-Butoxy)carbonyl]amino]-2,4,5-trifluorobenzenebutanoicacid |
| (S)-3-((tert-Butoxycarbonyl)amino)-4-(2,4,5-trifluorophenyl)butanoic acid |
| Sitagliptin Impurity 11 |
