Introduction：Basic information about CAS 7147-68-4|N-methylnaphthalene-2-sulfonamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-methylnaphthalene-2-sulfonamide |
|---|
| CAS Number | 7147-68-4 | Molecular Weight | 221.27600 |
|---|
| Density | 1.27g/cm3 | Boiling Point | 392.2ºC at 760 mmHg |
|---|
| Molecular Formula | C11H11NO2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 191ºC |
|---|
Names
| Name | N-methylnaphthalene-2-sulfonamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.27g/cm3 |
|---|
| Boiling Point | 392.2ºC at 760 mmHg |
|---|
| Molecular Formula | C11H11NO2S |
|---|
| Molecular Weight | 221.27600 |
|---|
| Flash Point | 191ºC |
|---|
| Exact Mass | 221.05100 |
|---|
| PSA | 54.55000 |
|---|
| LogP | 3.21960 |
|---|
| Index of Refraction | 1.622 |
|---|
| InChIKey | XNIYIAVEWYEBND-UHFFFAOYSA-N |
|---|
| SMILES | CNS(=O)(=O)c1ccc2ccccc2c1 |
|---|
Synonyms
| N-methyl-naphthalene-2-sulfonamide |
| 2-Naphthaleneacetamide,N-methyl |
| N-methyl-2-naphthylsulfonamide |
| N-Methyl-2-naphthalin-acetamid |
| N-methyl-2-naphthalenesulphonamide |
| N-Methyl-naphthalin-2-sulfonamid |
| N-methyl-2-naphthalenesulfonamide |
