Introduction：Basic information about CAS 602-37-9|1-Chloro-8-nitronaphthalene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-Chloro-8-nitronaphthalene |
|---|
| CAS Number | 602-37-9 | Molecular Weight | 207.61300 |
|---|
| Density | 1.409g/cm3 | Boiling Point | 342.8ºC at 760 mmHg |
|---|
| Molecular Formula | C10H6ClNO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 161.1ºC |
|---|
Names
| Name | 1-Chloro-8-nitronaphthalene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.409g/cm3 |
|---|
| Boiling Point | 342.8ºC at 760 mmHg |
|---|
| Molecular Formula | C10H6ClNO2 |
|---|
| Molecular Weight | 207.61300 |
|---|
| Flash Point | 161.1ºC |
|---|
| Exact Mass | 207.00900 |
|---|
| PSA | 45.82000 |
|---|
| LogP | 3.92460 |
|---|
| Index of Refraction | 1.677 |
|---|
| InChIKey | QOHQXCPALCHOID-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1cccc2cccc(Cl)c12 |
|---|
Synonyms
| Naphthalene,1-chloro-8-nitro |
| 8-Chloro-1-nitronaphthalene |
| 1-Chlor-8-nitronaphtalin |
| 1-chloro-8-nitro-naphthalene |
| F0074-0022 |
| 1-Chlor-8-nitronaphthalin |
