Introduction：Basic information about CAS 6941-12-4|(2R)-2-(4-tert-butylphenoxy)propanoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (2R)-2-(4-tert-butylphenoxy)propanoate |
|---|
| CAS Number | 6941-12-4 | Molecular Weight | 222.28000 |
|---|
| Density | / | Boiling Point | 334ºC at 760 mmHg |
|---|
| Molecular Formula | C13H18O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 121ºC |
|---|
Names
| Name | 2-(4-tert-butylphenoxy)propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 334ºC at 760 mmHg |
|---|
| Molecular Formula | C13H18O3 |
|---|
| Molecular Weight | 222.28000 |
|---|
| Flash Point | 121ºC |
|---|
| Exact Mass | 222.12600 |
|---|
| PSA | 46.53000 |
|---|
| LogP | 2.83600 |
|---|
| InChIKey | DMJZZNRMJJGRNF-UHFFFAOYSA-N |
|---|
| SMILES | CC(Oc1ccc(C(C)(C)C)cc1)C(=O)O |
|---|
Safety Information
Customs
| HS Code | 2918990090 |
|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 2-[4-(1,1-dimethylethyl)phenoxy]-propanoic acid |
| 2-(p-tert-butylphenoxy)propionic acid |
| 2-(4-tert-Butyl-phenoxy)-propionsaeure |
| 2-(3,4-DIMETHOXY-PHENYL)-IMIDAZO[1,2-A]PYRIDINE-3 |
| 2-(4-t-Butylphenoxy)propionic acid |
| 2-(4-tert-butyl-phenoxy)-propionic acid |
| O-(4-tert.-Butyl-phenyl)-DL-milchsaeure |
| 2-[4-(tert-butyl)phenoxy]propanoic acid |
