Introduction：Basic information about CAS 3304-51-6|H-Orn(Z)-OH, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | H-Orn(Z)-OH |
|---|
| CAS Number | 3304-51-6 | Molecular Weight | 266.293 |
|---|
| Density | 1.234 g/cm3 | Boiling Point | 492.2±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H18N2O4 | Melting Point | >220ºC |
|---|
| MSDS | / | Flash Point | 251.4±28.7 °C |
|---|
Names
| Name | N'-Cbz-L-ornithine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.234 g/cm3 |
|---|
| Boiling Point | 492.2±45.0 °C at 760 mmHg |
|---|
| Melting Point | >220ºC |
|---|
| Molecular Formula | C13H18N2O4 |
|---|
| Molecular Weight | 266.293 |
|---|
| Flash Point | 251.4±28.7 °C |
|---|
| Exact Mass | 266.126648 |
|---|
| PSA | 101.65000 |
|---|
| LogP | 1.43 |
|---|
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.556 |
|---|
| InChIKey | VULSXQYFUHKBAN-NSHDSACASA-N |
|---|
| SMILES | NC(CCCNC(=O)OCc1ccccc1)C(=O)O |
|---|
| Storage condition | −20°C |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| EINECS 221-980-8 |
| MFCD00037220 |
| Benzene, [[[[[(1S)-4-ammonio-1-carboxybutyl]amino]carbonyl]oxy]methyl]-, inner salt |
| Cbz-L-Hyp-OBn |
| N-Cbz-4-hydroxyproline benzyl ester |
| (S)-2-Amino-5-(((benzyloxy)carbonyl)amino)pentanoic acid |
| H-Orn(Cbz)-OH |
| N5-benzyloxycarbonyl-L-ornithine |
| Cbz-L-ornithine NCA |
| 1-Butanaminium, 1-carboxy-4-[[(phenylmethoxy)carbonyl]amino]-, inner salt, (1S)- |
| (2S)-2-amino-5-{[(benzyloxy)carbonyl]amino}pentanoic acid |
| Cbz-L-ornithine |
| (2S)-2-Ammonio-5-{[(benzyloxy)carbonyl]amino}pentanoate |
| (2S)-5-Ammonio-2-{[(benzyloxy)carbonyl]amino}pentanoate |
| Nω-CBz-L-Ornithine |
| H-Orn(Z)-OH |
