Introduction：Basic information about CAS 33173-55-6|Boc-4-azido-Phe-OH, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Boc-4-azido-Phe-OH |
|---|
| CAS Number | 33173-55-6 | Molecular Weight | 306.31700 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C14H18N4O4 | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | Boc-4-azido-Phe-OH |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C14H18N4O4 |
|---|
| Molecular Weight | 306.31700 |
|---|
| Exact Mass | 306.13300 |
|---|
| PSA | 125.38000 |
|---|
| LogP | 2.99246 |
|---|
| InChIKey | PZWGGRIVPTXYGU-NSHDSACASA-N |
|---|
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccc(N=[N+]=[N-])cc1)C(=O)O |
|---|
| Storage condition | -15°C |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| Boc-DL-Phg-OH |
| N-Boc-L-p-azidophenylalanine |
| 4-azido-N-Boc-phenylalanine |
| Boc-P-Fluoro-Dl-Phe-Oh |
| tert-Butyloxycarbonyl-4-azido-L-phenylalanin |
| BOC-d-4-Fluorophenylalanine |
| Boc-L-Phe(4-azido)-OH |
