Introduction：Basic information about CAS 65911-46-8|2-Carbamoyl-6-nitrobenzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Carbamoyl-6-nitrobenzoic acid |
|---|
| CAS Number | 65911-46-8 | Molecular Weight | 210.144 |
|---|
| Density | 1.6±0.1 g/cm3 | Boiling Point | 394.2±32.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H6N2O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 192.2±25.1 °C |
|---|
Names
| Name | 2-Carbamoyl-6-nitrobenzoic Acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|
| Boiling Point | 394.2±32.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H6N2O5 |
|---|
| Molecular Weight | 210.144 |
|---|
| Flash Point | 192.2±25.1 °C |
|---|
| Exact Mass | 210.027664 |
|---|
| PSA | 126.21000 |
|---|
| LogP | -0.27 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.656 |
|---|
| InChIKey | QYLIVYPDIARSHA-UHFFFAOYSA-N |
|---|
| SMILES | NC(=O)c1cccc([N+](=O)[O-])c1C(=O)O |
|---|
Synonyms
| 6-Nitro-phthalamidsaeure |
| 6-nitro-phthalamic acid |
| 2-aminocarbonyl-6-nitro-benzoic acid |
| 3-nitrophthalic monoamide |
| 2-Carbamoyl-6-nitrobenzoic acid |
| Benzoic acid, 2-(aminocarbonyl)-6-nitro- |
