Introduction：Basic information about CAS 669713-86-4|(3'-Fluoro-3-biphenylyl)acetic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (3'-Fluoro-3-biphenylyl)acetic acid |
|---|
| CAS Number | 669713-86-4 | Molecular Weight | 230.234 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 385.6±22.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H11FO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 187.0±22.3 °C |
|---|
Names
| Name | 2-[3-(3-fluorophenyl)phenyl]acetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 385.6±22.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H11FO2 |
|---|
| Molecular Weight | 230.234 |
|---|
| Flash Point | 187.0±22.3 °C |
|---|
| Exact Mass | 230.074310 |
|---|
| PSA | 37.30000 |
|---|
| LogP | 3.29 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.579 |
|---|
| InChIKey | AMMCIAQLNFOHTP-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)Cc1cccc(-c2cccc(F)c2)c1 |
|---|
Synonyms
| 3'-fluoro-biphenyl-3-acetic acid |
| 3-Biphenyl-3'-fluoro-aceticacid |
| (3'-Fluorobiphenyl-3-yl)acetic acid |
| [1,1'-Biphenyl]-3-acetic acid, 3'-fluoro- |
| (3'-Fluoro-3-biphenylyl)acetic acid |
