Introduction：Basic information about CAS 669713-87-5|(4'-Chloro-2-biphenylyl)acetic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (4'-Chloro-2-biphenylyl)acetic acid |
|---|
| CAS Number | 669713-87-5 | Molecular Weight | 246.689 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 427.0±33.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H11ClO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 212.0±25.4 °C |
|---|
Names
| Name | 2-[2-(4-chlorophenyl)phenyl]acetic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 427.0±33.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H11ClO2 |
|---|
| Molecular Weight | 246.689 |
|---|
| Flash Point | 212.0±25.4 °C |
|---|
| Exact Mass | 246.044754 |
|---|
| PSA | 37.30000 |
|---|
| LogP | 3.83 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.605 |
|---|
| InChIKey | UWAXYNGFODQXHE-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)Cc1ccccc1-c1ccc(Cl)cc1 |
|---|
Synonyms
| 2-Biphenyl-4'-chloro-aceticacid |
| [1,1'-Biphenyl]-2-acetic acid, 4'-chloro- |
| (4'-Chlorobiphenyl-2-yl)acetic acid |
| (4'-Chloro-2-biphenylyl)acetic acid |
| 4'-Chloro-biphenyl-2-acetic acid |
