Introduction:Basic information about CAS 669-90-9|2-oxogluconic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-oxogluconic acid |
|---|
| CAS Number | 669-90-9 | Molecular Weight | 194.13900 |
|---|
| Density | 1.941g/cm3 | Boiling Point | 528.6ºC at 760 mmHg |
|---|
| Molecular Formula | C6H10O7 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 225ºC |
|---|
Names
| Name | 2-dehydro-D-gluconic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.941g/cm3 |
|---|
| Boiling Point | 528.6ºC at 760 mmHg |
|---|
| Molecular Formula | C6H10O7 |
|---|
| Molecular Weight | 194.13900 |
|---|
| Flash Point | 225ºC |
|---|
| Exact Mass | 194.04300 |
|---|
| PSA | 135.29000 |
|---|
| Index of Refraction | 1.663 |
|---|
| InChIKey | VBUYCZFBVCCYFD-JJYYJPOSSA-N |
|---|
| SMILES | O=C(O)C(=O)C(O)C(O)C(O)CO |
|---|
Synonyms
| epifriedelinyl acetate |
| Fremy's salt |
| epi-friedelanol acetate |
| 2-oxogluconic acid |
| epi-friedelanyl acetate |
| friedelanol methyl ether |
| fructonic acid |