Introduction：Basic information about CAS 905807-62-7|4-Chloro-6-methoxy-2-quinolinecarboxylic acid methyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Chloro-6-methoxy-2-quinolinecarboxylic acid methyl ester |
|---|
| CAS Number | 905807-62-7 | Molecular Weight | 251.66600 |
|---|
| Density | 1.32g/cm3 | Boiling Point | 382.9ºC at 760 mmHg |
|---|
| Molecular Formula | C12H10ClNO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 185.4ºC |
|---|
Names
| Name | methyl 4-chloro-6-methoxyquinoline-2-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.32g/cm3 |
|---|
| Boiling Point | 382.9ºC at 760 mmHg |
|---|
| Molecular Formula | C12H10ClNO3 |
|---|
| Molecular Weight | 251.66600 |
|---|
| Flash Point | 185.4ºC |
|---|
| Exact Mass | 251.03500 |
|---|
| PSA | 48.42000 |
|---|
| LogP | 2.68340 |
|---|
| Index of Refraction | 1.603 |
|---|
| InChIKey | YSQVEEOSHQVGMK-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1cc(Cl)c2cc(OC)ccc2n1 |
|---|
Synonyms
| methyl 4-chloro-6-methoxy-quinoline-2-carboxylate |
