Introduction：Basic information about CAS 65182-98-1|N-(2,4-Dichloro-5-methoxyphenyl)acetamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-(2,4-Dichloro-5-methoxyphenyl)acetamide |
|---|
| CAS Number | 65182-98-1 | Molecular Weight | 234.07900 |
|---|
| Density | 1.373 g/cm3 | Boiling Point | 381.2ºC at 760 mmHg |
|---|
| Molecular Formula | C9H9Cl2NO2 | Melting Point | 158-159ºC |
|---|
| MSDS | / | Flash Point | 184.3ºC |
|---|
Names
| Name | N-(2,4-Dichloro-5-methoxyphenyl)acetamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.373 g/cm3 |
|---|
| Boiling Point | 381.2ºC at 760 mmHg |
|---|
| Melting Point | 158-159ºC |
|---|
| Molecular Formula | C9H9Cl2NO2 |
|---|
| Molecular Weight | 234.07900 |
|---|
| Flash Point | 184.3ºC |
|---|
| Exact Mass | 233.00100 |
|---|
| PSA | 41.82000 |
|---|
| LogP | 3.60990 |
|---|
| Index of Refraction | 1.583 |
|---|
| InChIKey | CTRIHOCZGTYVOA-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc(NC(C)=O)c(Cl)cc1Cl |
|---|
Safety Information
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 4,6-dichloro-3-methoxyacetanilide |
| 4.6-Dichlor-3-acetamino-anisol |
| Essigsaeure-(2,4-dichlor-5-methoxy-anilid) |
| I01-7669 |
| 4.6-Dichlor-3-acetamino-phenol-methylaether |
| 2,4-dichloro-5-methoxyacetanilide |
| Acetamide,N-(2,4-dichloro-5-methoxyphenyl) |
| 5-Methoxy-2,4-dichloracetanilid |
| acetic acid-(2,4-dichloro-5-methoxy-anilide) |
