Introduction：Basic information about CAS 33155-60-1|Methyl 4-tert-butylphenylacetate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methyl 4-tert-butylphenylacetate |
|---|
| CAS Number | 33155-60-1 | Molecular Weight | 206.281 |
|---|
| Density | 1.0±0.1 g/cm3 | Boiling Point | 268.2±9.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H18O2 | Melting Point | / |
|---|
| MSDS | Chinese | Flash Point | 98.7±17.1 °C |
|---|
Names
| Name | Methyl [4-(2-methyl-2-propanyl)phenyl]acetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.0±0.1 g/cm3 |
|---|
| Boiling Point | 268.2±9.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H18O2 |
|---|
| Molecular Weight | 206.281 |
|---|
| Flash Point | 98.7±17.1 °C |
|---|
| Exact Mass | 206.130676 |
|---|
| PSA | 26.30000 |
|---|
| LogP | 3.65 |
|---|
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.492 |
|---|
| InChIKey | JNXWYJWBRZOTAF-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(CC(=O)OC(C)(C)C)cc1 |
|---|
Safety Information
| Safety Phrases | S24/25 |
|---|
| HS Code | 2916399090 |
|---|
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| Methyl 4-tert-butylphenylacetate |
| Methyl (4-tert-butylphenyl)acetate |
| 1-Boc-4-methylenepiperidine |
| tert-butyl 4-methylene-1-piperidinecarboxylate |
| Acetic acid, (p-tert-butylphenyl)-, methyl ester |
| methyl 2-[4-(tert-butyl)phenyl]acetate |
| boc-4-methylenepiperidine |
| Methyl 4-(1,1-dimethylethyl)benzeneacetate |
| 1-t-butoxycarbonyl-4-methylidenepiperidine |
| 4-tert-Butylphenylacetic acid methyl ester |
| Benzeneacetic acid, 4-(1,1-dimethylethyl)-, methyl ester |
| Methyl [4-(2-methyl-2-propanyl)phenyl]acetate |
| 4-Tert-butylphenylaceticacidmethylester |
| N-Boc-4-methylenepiperidine |
| 4-methylene-N-Boc-piperidine |
| Methyl 2-(4-tert-butylphenyl)acetate |
| tert-butyl 4-methylenepiperidine-1-carboxylate |
| 4-methylbenzeneacetic acid 1,1-dimethylethyl ester |
| t-butyl p-tolylacetate |
| t-butyl 4-methylenetetrahydropyridine-1(2H)-carboxylate |
| 1,1-dimethylethyl 2-(4-methylphenyl)acetate |
| Methyl p-tert-butylphenylacetate |
| 1-N-Boc-4-methylenepiperidine |
| tert-butyl (4-methylphenyl)acetate |
