Introduction:Basic information about CAS 137932-76-4|Ethyl 4-acetoxy-8-methoxy-5-methyl-2-naphthoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ethyl 4-acetoxy-8-methoxy-5-methyl-2-naphthoate |
|---|
| CAS Number | 137932-76-4 | Molecular Weight | 302.32200 |
|---|
| Density | 1.181g/cm3 | Boiling Point | 454.4ºC at 760 mmHg |
|---|
| Molecular Formula | C17H18O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 201.1ºC |
|---|
Names
| Name | Ethyl 4-acetoxy-8-methoxy-5-methyl-2-naphthoate |
|---|
Chemical & Physical Properties
| Density | 1.181g/cm3 |
|---|
| Boiling Point | 454.4ºC at 760 mmHg |
|---|
| Molecular Formula | C17H18O5 |
|---|
| Molecular Weight | 302.32200 |
|---|
| Flash Point | 201.1ºC |
|---|
| Exact Mass | 302.11500 |
|---|
| PSA | 61.83000 |
|---|
| LogP | 3.25880 |
|---|
| Vapour Pressure | 1.91E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.565 |
|---|
| InChIKey | UDIKVHZBUYFDED-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1cc(OC(C)=O)c2c(C)ccc(OC)c2c1 |
|---|