Introduction：Basic information about CAS 58584-88-6|2,5,6-Trichloronicotinoyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,5,6-Trichloronicotinoyl chloride |
|---|
| CAS Number | 58584-88-6 | Molecular Weight | 244.89000 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C6HCl4NO | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2,5,6-Trichloronicotinoyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C6HCl4NO |
|---|
| Molecular Weight | 244.89000 |
|---|
| Exact Mass | 242.88100 |
|---|
| PSA | 29.96000 |
|---|
| LogP | 3.42080 |
|---|
| InChIKey | DRWKYBUROSTSFN-UHFFFAOYSA-N |
|---|
| SMILES | O=C(Cl)c1cc(Cl)c(Cl)nc1Cl |
|---|
Safety Information
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 2,5,6-Trichlorpyridin-3-carbonsaeurechlorid |
| 3-Pyridinecarboxamide,2,5,6-trichloro |
| 2,5,6-Trichlor-nicotinoylchlorid |
| 2,5,6-trichloro-nicotinoyl chloride |
| 2,5,6-Trichloronicotinamide |
| 2,5,6-trichloro-pyridine-3-carboxylic acid chloride |
| 2,5,6-trichloro-pyridine-3-carboxamide |
