Introduction：Basic information about CAS 65619-09-2|1-(2-Methylphenyl)-4-oxocyclohexanecarbonitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(2-Methylphenyl)-4-oxocyclohexanecarbonitrile |
|---|
| CAS Number | 65619-09-2 | Molecular Weight | 213.275 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 389.7±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H15NO | Melting Point | / |
|---|
| MSDS | / | Flash Point | 189.5±27.9 °C |
|---|
Names
| Name | 1-(2-methylphenyl)-4-oxocyclohexane-1-carbonitrile |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 389.7±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H15NO |
|---|
| Molecular Weight | 213.275 |
|---|
| Flash Point | 189.5±27.9 °C |
|---|
| Exact Mass | 213.115356 |
|---|
| PSA | 40.86000 |
|---|
| LogP | 2.00 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.552 |
|---|
| InChIKey | ALYQPOYEXMIQDZ-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccccc1C1(C#N)CCC(=O)CC1 |
|---|
Safety Information
Customs
| HS Code | 2926909090 |
|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 4-methylphenyl-4-cyano-cyclohexanone |
| 4-Cyano-4-(o-tolyl)-cyclohexanon |
| 4-oxo-1-o-tolylcyclohexanecarbonitrile |
| 1-cyano-1-(2-methylphenyl)cyclohexan-4-one |
| Cyclohexanecarbonitrile, 1-(2-methylphenyl)-4-oxo- |
| 1-(2-Methylphenyl)-4-oxocyclohexanecarbonitrile |
| 4-cyano-4-(o-tolyl)cyclohexanone |
| 4-Cyano-4-(2-methylphenyl)cyclohexanone |
