Introduction:Basic information about CAS 106635-86-3|Tafenoquine succinate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Tafenoquine succinate |
|---|
| CAS Number | 106635-86-3 | Molecular Weight | 378.34500 |
|---|
| Density | 1.316g/cm3 | Boiling Point | 486.277ºC at 760 mmHg |
|---|
| Molecular Formula | C19H17F3N2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 247.892ºC |
|---|
Names
| Name | 2,6-dimethoxy-4-methyl-5-[3-(trifluoromethyl)phenoxy]quinolin-8-amine |
|---|
Chemical & Physical Properties
| Density | 1.316g/cm3 |
|---|
| Boiling Point | 486.277ºC at 760 mmHg |
|---|
| Molecular Formula | C19H17F3N2O3 |
|---|
| Molecular Weight | 378.34500 |
|---|
| Flash Point | 247.892ºC |
|---|
| Exact Mass | 378.11900 |
|---|
| PSA | 66.60000 |
|---|
| LogP | 5.53490 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.583 |
|---|
| InChIKey | USGZHEQRIPMHCK-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc(C)c2c(Oc3cccc(C(F)(F)F)c3)c(OC)cc(N)c2n1 |
|---|