Introduction：Basic information about CAS 101238-51-1|Levemopamil, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Levemopamil |
|---|
| CAS Number | 101238-51-1 | Molecular Weight | 334.49800 |
|---|
| Density | 1.003g/cm3 | Boiling Point | 485.8ºC at 760mmHg |
|---|
| Molecular Formula | C23H30N2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 201.1ºC |
|---|
Names
| Name | (2S)-2-Isopropyl-5-[methyl(2-phenylethyl)amino]-2-phenylpentaneni trile |
|---|
Chemical & Physical Properties
| Density | 1.003g/cm3 |
|---|
| Boiling Point | 485.8ºC at 760mmHg |
|---|
| Molecular Formula | C23H30N2 |
|---|
| Molecular Weight | 334.49800 |
|---|
| Flash Point | 201.1ºC |
|---|
| Exact Mass | 334.24100 |
|---|
| PSA | 27.03000 |
|---|
| LogP | 5.05868 |
|---|
| Vapour Pressure | 1.37E-09mmHg at 25°C |
|---|
| Index of Refraction | 1.543 |
|---|
| InChIKey | DWAWDSVKAUWFHC-QHCPKHFHSA-N |
|---|
| SMILES | CC(C)C(C#N)(CCCN(C)CCc1ccccc1)c1ccccc1 |
|---|
