Introduction：Basic information about CAS 613-11-6|TRX-0237, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | TRX-0237 |
|---|
| CAS Number | 613-11-6 | Molecular Weight | 285.40700 |
|---|
| Density | 1.201g/cm3 | Boiling Point | 491.7ºC at 760 mmHg |
|---|
| Molecular Formula | C16H19N3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 251.2ºC |
|---|
Names
| Name | 3-N,3-N,7-N,7-N-tetramethyl-10H-phenothiazine-3,7-diamine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.201g/cm3 |
|---|
| Boiling Point | 491.7ºC at 760 mmHg |
|---|
| Molecular Formula | C16H19N3S |
|---|
| Molecular Weight | 285.40700 |
|---|
| Flash Point | 251.2ºC |
|---|
| Exact Mass | 285.13000 |
|---|
| PSA | 43.81000 |
|---|
| LogP | 4.16480 |
|---|
| Index of Refraction | 1.675 |
|---|
| InChIKey | QTWZICCBKBYHDM-UHFFFAOYSA-N |
|---|
| SMILES | CN(C)c1ccc2c(c1)Sc1cc(N(C)C)ccc1N2 |
|---|
Synonyms
| leucoform |
| Reduced methylene blue |
| N,N,N',N'-Tetramethyl-10H-phenothiazine-3,7-diamine |
| Panatone |
| Leukomethylene blue |
| N3,N3,N7,N7-tetramethyl-10H-phenothiazine-3,7-diamine |
| methylene white |
| 2w9i |
| Leucomethylene blue |
