Introduction：Basic information about CAS 33396-37-1|meproscillarin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | meproscillarin |
|---|
| CAS Number | 33396-37-1 | Molecular Weight | 544.67600 |
|---|
| Density | 1.29g/cm3 | Boiling Point | 709.8ºC at 760mmHg |
|---|
| Molecular Formula | C31H44O8 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 227.5ºC |
|---|
Names
| Name | 5-[(3S,8R,9S,10R,13R,14S,17R)-3-[(2S,5R)-3,4-dihydroxy-5-methoxy-6-methyloxan-2-yl]oxy-14-hydroxy-10,13-dimethyl-1,2,3,6,7,8,9,11,12,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pyran-2-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.29g/cm3 |
|---|
| Boiling Point | 709.8ºC at 760mmHg |
|---|
| Molecular Formula | C31H44O8 |
|---|
| Molecular Weight | 544.67600 |
|---|
| Flash Point | 227.5ºC |
|---|
| Exact Mass | 544.30400 |
|---|
| PSA | 118.59000 |
|---|
| LogP | 3.66790 |
|---|
| Index of Refraction | 1.599 |
|---|
| InChIKey | RKWPZPDLTYBKCL-RVZGXXANSA-N |
|---|
| SMILES | COC1C(C)OC(OC2C=C3CCC4C(CCC5(C)C(c6ccc(=O)oc6)CCC45O)C3(C)CC2)C(O)C1O |
|---|
Synonyms
| 4-O-Methyl-proscillaridin |
| Meproscillarin-T-markiert |
| Meproscilarina [Spanish] |
| Meproscillarin |
| Meproscillarinum [INN-Latin] |
| Meproscillarine [INN-French] |
| Proscillaridin-4'-methylether |
| Clift |
| Knoll 570 |
| Meproscilarina [INN-Spanish] |
| Rambufaside |
