Introduction：Basic information about CAS 56097-80-4|Valconazole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Valconazole |
|---|
| CAS Number | 56097-80-4 | Molecular Weight | 341.23200 |
|---|
| Density | 1.24g/cm3 | Boiling Point | 501.1ºC at 760mmHg |
|---|
| Molecular Formula | C16H18Cl2N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 256.9ºC |
|---|
Names
| Name | 2-(2,4-dichlorophenoxy)-1-imidazol-1-yl-4,4-dimethylpentan-3-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.24g/cm3 |
|---|
| Boiling Point | 501.1ºC at 760mmHg |
|---|
| Molecular Formula | C16H18Cl2N2O2 |
|---|
| Molecular Weight | 341.23200 |
|---|
| Flash Point | 256.9ºC |
|---|
| Exact Mass | 340.07500 |
|---|
| PSA | 44.12000 |
|---|
| LogP | 4.25270 |
|---|
| Index of Refraction | 1.568 |
|---|
| InChIKey | JDSGUKVHXNGRIP-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)C(=O)C(Cn1ccnc1)Oc1ccc(Cl)cc1Cl |
|---|
Synonyms
| (-)-2-(2,4-Dichlorophenoxy)-1-imidazol-1-yl)-4,4-dimethyl-3-pentanone |
| Valconazole |
| 2-(2,4-dichlorophenoxy)-1-imidazolyl-(1)-4,4-dimethyl-pentan-3-one |
| (R,S)-2-(2,4-Dichlorphenoxy)-1-imidazolyl-4,4-dimethyl-3-pentanon |
| 2-(2,4-dichloro-phenoxy)-1-imidazol-1-yl-4,4-dimethyl-pentan-3-one |
| Valconazolum |
