Introduction：Basic information about CAS 72005-58-4|vadocaine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | vadocaine |
|---|
| CAS Number | 72005-58-4 | Molecular Weight | 304.42700 |
|---|
| Density | 1.053g/cm3 | Boiling Point | 442ºC at 760 mmHg |
|---|
| Molecular Formula | C18H28N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 221.1ºC |
|---|
Names
| Name | N-(2-methoxy-4,6-dimethylphenyl)-3-(2-methylpiperidin-1-yl)propanamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.053g/cm3 |
|---|
| Boiling Point | 442ºC at 760 mmHg |
|---|
| Molecular Formula | C18H28N2O2 |
|---|
| Molecular Weight | 304.42700 |
|---|
| Flash Point | 221.1ºC |
|---|
| Exact Mass | 304.21500 |
|---|
| PSA | 45.06000 |
|---|
| LogP | 4.10240 |
|---|
| Index of Refraction | 1.54 |
|---|
| InChIKey | UJCARUGFZOJPMI-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc(C)cc(C)c1NC(=O)CCN1CCCCC1C |
|---|
Synonyms
| Vadocainum [Latin] |
| Vadocaine [INN] |
| Vadocaina [Spanish] |
| Vadocainum |
| ( inverted exclamation markA)-6'-methoxy-2-methyl-1-piperidinepropiono-2',4'-xylidide |
| Vadocaina |
| Vadocaine |
