Introduction：Basic information about CAS 3295-78-1|dimidazon, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | dimidazon |
|---|
| CAS Number | 3295-78-1 | Molecular Weight | 232.235 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 389.8±52.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H12N2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 189.5±30.7 °C |
|---|
Names
| Name | dimidazon |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 389.8±52.0 °C at 760 mmHg |
|---|
| Molecular Formula | C12H12N2O3 |
|---|
| Molecular Weight | 232.235 |
|---|
| Flash Point | 189.5±30.7 °C |
|---|
| Exact Mass | 232.084793 |
|---|
| PSA | 53.35000 |
|---|
| LogP | 0.48 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.567 |
|---|
| InChIKey | NEFZKJCNHBXWLP-UHFFFAOYSA-N |
|---|
| SMILES | COc1cnn(-c2ccccc2)c(=O)c1OC |
|---|
Safety Information
Customs
| HS Code | 2933990090 |
|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| dimidazon |
| dimethoxy-3,4 nitro-6 chalcone |
| 4,5-Dimethoxy-2-phenyl-3(2H)-pyridazinone |
| (4,5-dimethoxy-2-nitro-phenyl)-acetonitrile |
| (4,5-Dimethoxy-2-nitro-phenyl)-acetonitril |
| 4,5-dimethoxy-2-phenyl-2H-pyridazin-3-one |
| 3(2H)-Pyridazinone, 4,5-dimethoxy-2-phenyl- |
| 4,5-Dimethoxy-2-phenylpyridazin-3(2H)-one |
| 1-Phenyl-4.5-dimethoxy-6<1H>-pyridazinon |
| 4,5-Dimethoxy-2-nitrobenzylcyanid |
| 2-phenyl-4,5-dimethoxypyridazin-3-one |
| 4,5-Dimethoxy-2-phenylpyridazin-3(2H)-on |
| 2-phenyl-4,5-dimethoxy-pyridazinone-3 |
| 4-nitro-5-cyanomethylveratrole |
