Introduction：Basic information about CAS 18254-13-2|2,4,6-Tris(1-phenylethyl)phenol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,4,6-Tris(1-phenylethyl)phenol |
|---|
| CAS Number | 18254-13-2 | Molecular Weight | 406.559 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 519.3±19.0 °C at 760 mmHg |
|---|
| Molecular Formula | C30H30O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 238.4±13.4 °C |
|---|
Names
| Name | 2,4,6-Tris(1-phenylethyl)phenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 519.3±19.0 °C at 760 mmHg |
|---|
| Molecular Formula | C30H30O |
|---|
| Molecular Weight | 406.559 |
|---|
| Flash Point | 238.4±13.4 °C |
|---|
| Exact Mass | 406.229675 |
|---|
| PSA | 20.23000 |
|---|
| LogP | 8.49 |
|---|
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
|---|
| Index of Refraction | 1.604 |
|---|
| InChIKey | BYLSIPUARIZAHZ-UHFFFAOYSA-N |
|---|
| SMILES | CC(c1ccccc1)c1cc(C(C)c2ccccc2)c(O)c(C(C)c2ccccc2)c1 |
|---|
Synonyms
| 2,4,6-Tris(1-phenylethyl)phenol |
| 1YR&R BQ CY1&R& EY1&R |
| Phenol, 2,4,6-tris(1-phenylethyl)- |
| EINECS 242-128-1 |
| 2,4,6-Tris-(1-phenyl-aethyl)-phenol |
| 2,4,6-Tris(α-methylbenzyl)phenol |
| 2,4,6-tris-(1-phenyl-ethyl)-phenol |
| Opt.-inakt. 2-Hydroxy-1.3.5-tris-(1-phenyl-aethyl)-benzol |
