Introduction：Basic information about CAS 6358-87-8|Pigment Red 38, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Pigment Red 38 |
|---|
| CAS Number | 6358-87-8 | Molecular Weight | 739.56400 |
|---|
| Density | 1.45 g/cm3 | Boiling Point | 819.5ºC at 760 mmHg |
|---|
| Molecular Formula | C36H28Cl2N8O6 | Melting Point | 173 - 178ºC |
|---|
| MSDS | / | Flash Point | 449.4ºC |
|---|
Names
| Name | ethyl 4-[[2-chloro-4-[3-chloro-4-[(3-ethoxycarbonyl-5-oxo-1-phenyl-4H-pyrazol-4-yl)diazenyl]phenyl]phenyl]diazenyl]-5-oxo-1-phenyl-4H-pyrazole-3-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.45 g/cm3 |
|---|
| Boiling Point | 819.5ºC at 760 mmHg |
|---|
| Melting Point | 173 - 178ºC |
|---|
| Molecular Formula | C36H28Cl2N8O6 |
|---|
| Molecular Weight | 739.56400 |
|---|
| Flash Point | 449.4ºC |
|---|
| Exact Mass | 738.15100 |
|---|
| PSA | 167.38000 |
|---|
| LogP | 6.49800 |
|---|
| Index of Refraction | 1.69 |
|---|
| InChIKey | PLYDMIIYRWUYBP-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)C1=NN(c2ccccc2)C(=O)C1N=Nc1ccc(-c2ccc(N=NC3C(=O)N(c4ccccc4)N=C3C(=O)OCC)c(Cl)c2)cc1Cl |
|---|
Synonyms
| Silotermo Red B |
| Vulcan Fast Red B |
| Irgaplast Red P |
| Benzidine Red |
| Pyrazolone Red |
| Pigment Red 38 |
| Piper Red |
| Rubber Fast Red B |
| Symuler Fast Pyrazolone Red B |
| Pyrazolone Red Y |
