Introduction：Basic information about CAS 64139-21-5|diethyl 4-hydroxyphthalate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | diethyl 4-hydroxyphthalate |
|---|
| CAS Number | 64139-21-5 | Molecular Weight | 238.23700 |
|---|
| Density | 1.211g/cm3 | Boiling Point | 356.7ºC at 760 mmHg |
|---|
| Molecular Formula | C12H14O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 133.5ºC |
|---|
Names
| Name | diethyl 4-hydroxybenzene-1,2-dicarboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.211g/cm3 |
|---|
| Boiling Point | 356.7ºC at 760 mmHg |
|---|
| Molecular Formula | C12H14O5 |
|---|
| Molecular Weight | 238.23700 |
|---|
| Flash Point | 133.5ºC |
|---|
| Exact Mass | 238.08400 |
|---|
| PSA | 72.83000 |
|---|
| LogP | 1.74560 |
|---|
| Index of Refraction | 1.532 |
|---|
| InChIKey | XESMXDXQZBMELS-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1ccc(O)cc1C(=O)OCC |
|---|
Safety Information
Customs
| HS Code | 2918199090 |
|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| Diethyl-4-hydroxyphthalat |
| Diethyl 4-hydroxyphthalate |
| 4-hydroxy-phthalic acid diethyl ester |
| 4-Hydroxy-phthalsaeure-diaethylester |
| EINECS 264-703-6 |
