Introduction：Basic information about CAS 71208-54-3|diethyl (6-chloro-2,3,4,9-tetrahydro-1H-carbazol-2-yl)methylmalonate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | diethyl (6-chloro-2,3,4,9-tetrahydro-1H-carbazol-2-yl)methylmalonate |
|---|
| CAS Number | 71208-54-3 | Molecular Weight | 377.86200 |
|---|
| Density | 1.24g/cm3 | Boiling Point | 497.3ºC at 760 mmHg |
|---|
| Molecular Formula | C20H24ClNO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 254.5ºC |
|---|
Names
| Name | diethyl 2-[(6-chloro-2,3,4,9-tetrahydro-1H-carbazol-2-yl)methyl]propanedioate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.24g/cm3 |
|---|
| Boiling Point | 497.3ºC at 760 mmHg |
|---|
| Molecular Formula | C20H24ClNO4 |
|---|
| Molecular Weight | 377.86200 |
|---|
| Flash Point | 254.5ºC |
|---|
| Exact Mass | 377.13900 |
|---|
| PSA | 68.39000 |
|---|
| LogP | 4.05870 |
|---|
| Index of Refraction | 1.576 |
|---|
| InChIKey | XWJZVIIPTMHYNQ-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)C(C)(C(=O)OCC)C1CCc2c([nH]c3ccc(Cl)cc23)C1 |
|---|
Synonyms
| Diethyl (6-chloro-2,3,4,9-tetrahydro-1H-carbazol-2-yl)methylmalonate |
| Propanedioic acid,2-(6-chloro-2,3,4,9-tetrahydro-1H-carbazol-2-yl)-2-methyl-,1,3-diethyl ester |
| Propanedioicacid,(6-chloro-2,3,4,9-tetrahydro-1H-carbazol-2-yl)methyl-,diethyl ester(9CI) |
| (6-chloro-1,2,3,4-tetrahydro-2-carbazolyl)methylmalonic acid diethyl ester |
| doethyl(6-chloro-1,2,3,4-tetrahydro-2-carbazolyl)methyl malonate |
