Introduction:Basic information about CAS 82674-08-6|2-(3,5-dichlorophenoxy)-5-nitrobenzonitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(3,5-dichlorophenoxy)-5-nitrobenzonitrile |
|---|
| CAS Number | 82674-08-6 | Molecular Weight | 309.10400 |
|---|
| Density | 1.54g/cm3 | Boiling Point | 411.9ºC at 760 mmHg |
|---|
| Molecular Formula | C13H6Cl2N2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 202.9ºC |
|---|
Names
| Name | 2-(3,5-dichlorophenoxy)-5-nitrobenzonitrile |
|---|
Chemical & Physical Properties
| Density | 1.54g/cm3 |
|---|
| Boiling Point | 411.9ºC at 760 mmHg |
|---|
| Molecular Formula | C13H6Cl2N2O3 |
|---|
| Molecular Weight | 309.10400 |
|---|
| Flash Point | 202.9ºC |
|---|
| Exact Mass | 307.97600 |
|---|
| PSA | 78.84000 |
|---|
| LogP | 5.08878 |
|---|
| Index of Refraction | 1.655 |
|---|
| InChIKey | QQLTXNQWBPBKDS-UHFFFAOYSA-N |
|---|
| SMILES | N#Cc1cc([N+](=O)[O-])ccc1Oc1cc(Cl)cc(Cl)c1 |
|---|