Introduction：Basic information about CAS 60682-24-8|sodium 2-(4-isobutylphenyl)butyrate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | sodium 2-(4-isobutylphenyl)butyrate |
|---|
| CAS Number | 60682-24-8 | Molecular Weight | 242.28900 |
|---|
| Density | / | Boiling Point | 335.1ºC at 760 mmHg |
|---|
| Molecular Formula | C14H19NaO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 232.1ºC |
|---|
Names
| Name | sodium,2-[4-(2-methylpropyl)phenyl]butanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 335.1ºC at 760 mmHg |
|---|
| Molecular Formula | C14H19NaO2 |
|---|
| Molecular Weight | 242.28900 |
|---|
| Flash Point | 232.1ºC |
|---|
| Exact Mass | 242.12800 |
|---|
| PSA | 40.13000 |
|---|
| LogP | 2.12860 |
|---|
| InChIKey | SJBWJHOBCVAGGD-UHFFFAOYSA-M |
|---|
| SMILES | CCC(C(=O)[O-])c1ccc(CC(C)C)cc1.[Na+] |
|---|
Synonyms
| sodium salt of 2-(4-isobutylphenyl)butyric acid |
| Sodium 2-(4-isobutylphenyl)butyrate |
| 2-(4-isobutylphenyl)butyric acid sodium salt |
| EINECS 262-374-3 |
| Benzeneacetic acid,a-ethyl-4-(2-methylpropyl)-,sodium salt (1:1) |
| Benzeneaceticacid,a-ethyl-4-(2-methylpropyl)-,sodium salt (9CI) |
