Introduction:Basic information about CAS 60683-03-6|diethyl 3,3'-(vinylenedi-4,1-phenylene)bisacrylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | diethyl 3,3'-(vinylenedi-4,1-phenylene)bisacrylate |
|---|
| CAS Number | 60683-03-6 | Molecular Weight | 376.44500 |
|---|
| Density | 1.149g/cm3 | Boiling Point | 546.9ºC at 760 mmHg |
|---|
| Molecular Formula | C24H24O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 276ºC |
|---|
Names
| Name | ethyl 3-[4-[2-[4-(3-ethoxy-3-oxoprop-1-enyl)phenyl]ethenyl]phenyl]prop-2-enoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.149g/cm3 |
|---|
| Boiling Point | 546.9ºC at 760 mmHg |
|---|
| Molecular Formula | C24H24O4 |
|---|
| Molecular Weight | 376.44500 |
|---|
| Flash Point | 276ºC |
|---|
| Exact Mass | 376.16700 |
|---|
| PSA | 52.60000 |
|---|
| LogP | 5.00960 |
|---|
| Index of Refraction | 1.636 |
|---|
| InChIKey | KOWIGDVPOVFBLV-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)C=Cc1ccc(C=Cc2ccc(C=CC(=O)OCC)cc2)cc1 |
|---|
Synonyms
| 2-Propenoic acid,3,3'-(1,2-ethenediyldi-4,1-phenylene)bis-,diethyl ester |
| 2-Propenoic acid,3,3'-(1,2-ethenediyldi-4,1-phenylene)bis-,1,1'-diethyl ester |
| Diethyl 3,3'-(vinylenedi-4,1-phenylene)bisacrylate |
| 4,4'-bis-(ethoxycarbonyl-vinyl)-stilbene |
| EINECS 262-376-4 |